4,4'-Methylenebis(2-tert-butyl-6-methylphenol)
Modify Date: 2025-08-26 17:37:16
4,4'-Methylenebis(2-tert-butyl-6-methylphenol) structure
|
Common Name | 4,4'-Methylenebis(2-tert-butyl-6-methylphenol) | ||
|---|---|---|---|---|
| CAS Number | 96-65-1 | Molecular Weight | 340.49900 | |
| Density | 1.026 g/cm3 | Boiling Point | 437.7ºC at 760 mmHg | |
| Molecular Formula | C23H32O2 | Melting Point | 76-78ºC | |
| MSDS | N/A | Flash Point | 186.3ºC | |
| Name | 2-tert-butyl-4-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]-6-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.026 g/cm3 |
|---|---|
| Boiling Point | 437.7ºC at 760 mmHg |
| Melting Point | 76-78ºC |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.49900 |
| Flash Point | 186.3ºC |
| Exact Mass | 340.24000 |
| PSA | 40.46000 |
| LogP | 5.90040 |
| Index of Refraction | 1.55 |
| InChIKey | RKLRVTKRKFEVQG-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cc2cc(C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
|
~%
4,4'-Methyleneb... CAS#:96-65-1 |
| Literature: Ambelang; Binder Journal of the American Chemical Society, 1953 , vol. 75, p. 947,948 |
|
~0%
4,4'-Methyleneb... CAS#:96-65-1 |
| Literature: Krysin; Khalikova; Khlebnikova; Nogina; Mamatyuk Russian Journal of General Chemistry, 2010 , vol. 80, # 11 p. 2290 - 2297 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,2'-Di-tert-butyl-6,6'-dimethyl-4,4'-methandiyl-di-phenol |
| 2,2'-di-tert-butyl-6,6'-dimethyl-4,4'-methanediyl-di-phenol |
| 6,6'-di-tert-butyl-4,4'-methylenedi-o-cresol |
| Ethyl Antioxidant 720 |