N'-(4-chlorophenyl)-1-methylimidazole-4-carboximidamide
Modify Date: 2025-08-25 16:42:37
N'-(4-chlorophenyl)-1-methylimidazole-4-carboximidamide structure
|
Common Name | N'-(4-chlorophenyl)-1-methylimidazole-4-carboximidamide | ||
|---|---|---|---|---|
| CAS Number | 959604-71-8 | Molecular Weight | 234.685 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 407.4±51.0 °C at 760 mmHg | |
| Molecular Formula | C11H11ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.2±30.4 °C | |
| Name | N'-(4-chlorophenyl)-1-methylimidazole-4-carboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 407.4±51.0 °C at 760 mmHg |
| Molecular Formula | C11H11ClN4 |
| Molecular Weight | 234.685 |
| Flash Point | 200.2±30.4 °C |
| Exact Mass | 234.067230 |
| PSA | 53.70000 |
| LogP | 2.04 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | QVFHJZWYKZXHEV-UHFFFAOYSA-N |
| SMILES | Cn1cnc(C(N)=Nc2ccc(Cl)cc2)c1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N'-(4-chlorophenyl)-1-methyl-4-imidazolecarboximidamide |
| N-(4-Chlorophenyl)1-methyl-1H-imidazole-4-carboximidamide |
| I14-4952 |
| N-(4-Chlorophenyl)-1-methyl-1H-imidazole-4-carboximidamide |
| 1H-Imidazole-4-carboximidamide, N-(4-chlorophenyl)-1-methyl- |