1-Isobutyl-7-nitro-1,2,3,4-tetrahydroquinoline structure
|
Common Name | 1-Isobutyl-7-nitro-1,2,3,4-tetrahydroquinoline | ||
|---|---|---|---|---|
| CAS Number | 959235-79-1 | Molecular Weight | 234.29400 | |
| Density | 1.114 | Boiling Point | N/A | |
| Molecular Formula | C13H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-methylpropyl)-7-nitro-3,4-dihydro-2H-quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.114 |
|---|---|
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.29400 |
| Exact Mass | 234.13700 |
| PSA | 49.06000 |
| LogP | 3.59160 |
| Index of Refraction | 1.551 |
| InChIKey | PPMVNPPYRKIWTP-UHFFFAOYSA-N |
| SMILES | CC(C)CN1CCCc2ccc([N+](=O)[O-])cc21 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Isobutyl-7-nitro-1,2,3,4-tetrahydroquinoline |