[4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxy)phenyl]methanol
Modify Date: 2025-08-26 07:54:12
![[4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxy)phenyl]methanol Structure](https://image.chemsrc.com/caspic/062/957206-65-4.png)
[4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxy)phenyl]methanol structure
|
Common Name | [4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxy)phenyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 957206-65-4 | Molecular Weight | 484.25200 | |
| Density | 1.421g/cm3 | Boiling Point | 313.1ºC at 760 mmHg | |
| Molecular Formula | C16H13F13O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 151ºC | |
| Name | [4-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxy)phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.421g/cm3 |
|---|---|
| Boiling Point | 313.1ºC at 760 mmHg |
| Molecular Formula | C16H13F13O2 |
| Molecular Weight | 484.25200 |
| Flash Point | 151ºC |
| Exact Mass | 484.07100 |
| PSA | 29.46000 |
| LogP | 6.07670 |
| Index of Refraction | 1.378 |
| InChIKey | PLXJZTAXKGDVFR-UHFFFAOYSA-N |
| SMILES | OCc1ccc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| 4-(4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluorononyloxy)benzyl alcohol |