2,3-Difluoro-5-nitrophenylboronic acid structure
|
Common Name | 2,3-Difluoro-5-nitrophenylboronic acid | ||
|---|---|---|---|---|
| CAS Number | 957060-82-1 | Molecular Weight | 202.90800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4BF2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,3-Difluoro-5-nitrophenyl)boronic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H4BF2NO4 |
|---|---|
| Molecular Weight | 202.90800 |
| Exact Mass | 203.02000 |
| PSA | 86.28000 |
| LogP | 0.07600 |
| InChIKey | AARSYRVYLRWEBG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(F)c(F)c(B(O)O)c1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (2,3-difluoro-5-nitrophenyl)boronic acid |