2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester
Modify Date: 2026-06-27 19:44:37
![2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester Structure](https://www.chemsrc.com/extcaspic/096/956707-57-6.png)
2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester structure
|
Common Name | 2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 956707-57-6 | Molecular Weight | 311.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8F3NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8F3NO5S |
|---|---|
| Molecular Weight | 311.24 |
| InChIKey | ZDSHKLYGWOAHJZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CS(=O)C1=C(C=C(C=C1)C(F)(F)F)[N+](=O)[O-] |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester? |
| A: Molecular formula of 2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester is C10H8F3NO5S. |
| Q: What is the InChIKey of 2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester? |
| A: InChIKey of 2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester is ZDSHKLYGWOAHJZ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester? |
| A: CAS number of 2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester is 956707-57-6. |
| Q: What is the English name of 2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester? |
| A: The English name of 2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester is 2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester. |
| Q: What is the Chinese name of 956707-57-6? |
| A: Chinese name of 956707-57-6 is 956707-57-6. |
| Q: What is the SMILES notation of 2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester? |
| A: SMILES notation of 2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester is COC(=O)CS(=O)C1=C(C=C(C=C1)C(F)(F)F)[N+](=O)[O-]. |
| Q: What is the molecular weight of 2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester? |
| A: Molecular weight of 2-[2-Nitro-4-(trifluoromethyl)phenyl]sulfinylacetic acid methyl ester is 311.24. |