diphenylphosphoric toluene-4-sulfonic anhydride
Modify Date: 2024-01-10 18:48:18
diphenylphosphoric toluene-4-sulfonic anhydride structure
|
Common Name | diphenylphosphoric toluene-4-sulfonic anhydride | ||
|---|---|---|---|---|
| CAS Number | 95667-04-2 | Molecular Weight | 404.37300 | |
| Density | 1.355g/cm3 | Boiling Point | 517.3ºC at 760mmHg | |
| Molecular Formula | C19H17O6PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.6ºC | |
| Name | diphenoxyphosphoryl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.355g/cm3 |
|---|---|
| Boiling Point | 517.3ºC at 760mmHg |
| Molecular Formula | C19H17O6PS |
| Molecular Weight | 404.37300 |
| Flash Point | 266.6ºC |
| Exact Mass | 404.04800 |
| PSA | 97.09000 |
| LogP | 6.04720 |
| Index of Refraction | 1.596 |
| InChIKey | LCYHSTVGKVUEKJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OP(=O)(Oc2ccccc2)Oc2ccccc2)cc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Dpptsa |
| Benzenesulfonic acid,4-methyl-,(SP-5-21) |
| Diphenylphosphoric toluene-4-sulfonic anhydride |
| {[(4-methylphenyl)sulfonyl]oxy}(diphenoxy)phosphane oxide |