Dallergy
Modify Date: 2025-08-27 20:55:17
Dallergy structure
|
Common Name | Dallergy | ||
|---|---|---|---|---|
| CAS Number | 956596-09-1 | Molecular Weight | 760.38100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C43H56ClN4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Dallergy |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C43H56ClN4O6 |
|---|---|
| Molecular Weight | 760.38100 |
| Exact Mass | 759.38900 |
| PSA | 127.68000 |
| LogP | 5.87600 |
| InChIKey | GMBYRECIACINKD-GFAZQMFJSA-N |
| SMILES | CN(C)CCC(c1ccc(Cl)cc1)c1ccccn1.CNCC(O)c1cccc(O)c1.C[N+]1(C)C2CC(OC(=O)C(CO)c3ccccc3)CC1C1OC12 |
| Drymax |
| Chlorpheniramine maleate / methscopolamine nitrate / phenylephrine hcl |
| Dehistine |
| Chlorpheniramine mixture with methscopolamine and phenylephrine |
| Extendryl |
| Scophist |
| Chlorpheniramine / methscopolamine / phenylephrine |