Methyl 2,4-dihydroxy-3-nitrobenzoate structure
|
Common Name | Methyl 2,4-dihydroxy-3-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 956105-56-9 | Molecular Weight | 213.144 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 296.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.3±25.9 °C | |
| Name | Methyl 2,4-dihydroxy-3-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 296.8±35.0 °C at 760 mmHg |
| Molecular Formula | C8H7NO6 |
| Molecular Weight | 213.144 |
| Flash Point | 133.3±25.9 °C |
| Exact Mass | 213.027344 |
| PSA | 112.58000 |
| LogP | 2.54 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | MGISJTNDNGBQKQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(O)c([N+](=O)[O-])c1O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| BENZOIC ACID,2,4-DIHYDROXY-3-NITRO-,METHYL ESTER |
| Methyl 2,4-dihydroxy-3-nitrobenzoate |
| 2,4-dihydroxy-3-nitrobenzoic acid methyl ester |
| Benzoic acid, 2,4-dihydroxy-3-nitro-, methyl ester |