5'-(2,3-Dihydroxypropoxy)-2'-hydroxypropiophenone
Modify Date: 2025-08-26 20:06:27
5'-(2,3-Dihydroxypropoxy)-2'-hydroxypropiophenone structure
|
Common Name | 5'-(2,3-Dihydroxypropoxy)-2'-hydroxypropiophenone | ||
|---|---|---|---|---|
| CAS Number | 956-23-0 | Molecular Weight | 240.25200 | |
| Density | 1.275g/cm3 | Boiling Point | 449.2ºC at 760 mmHg | |
| Molecular Formula | C12H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.6ºC | |
| Name | 1-[5-(2,3-dihydroxypropoxy)-2-hydroxyphenyl]propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.275g/cm3 |
|---|---|
| Boiling Point | 449.2ºC at 760 mmHg |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25200 |
| Flash Point | 173.6ºC |
| Exact Mass | 240.10000 |
| PSA | 86.99000 |
| LogP | 0.71690 |
| Index of Refraction | 1.569 |
| InChIKey | AQXAMCMWSDKKIG-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1cc(OCC(O)CO)ccc1O |
| HS Code | 2914509090 |
|---|
|
~%
5'-(2,3-Dihydro... CAS#:956-23-0 |
| Literature: Casadio; Pala; Crescenzi; Marazzi-Uberti; Fresia Arzneimittel-Forschung, 1966 , vol. 16, # 5 p. 592 - 596 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,2-Propanediol,3-(4-hydroxy-3-propionylphenoxy) |
| 5'-(2,3-Dihydroxypropoxy)-2'-hydroxypropiophenone |
| 3-(4-Hydroxy-3-propionylphenoxy)-1,2-propanediol |