dicloro(bis(1,1',1''-(phosphinetriyl)tripiperidine))palladium structure
|
Common Name | dicloro(bis(1,1',1''-(phosphinetriyl)tripiperidine))palladium | ||
|---|---|---|---|---|
| CAS Number | 955117-31-4 | Molecular Weight | 744.11100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H60Cl2N6P2Pd | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | dicloro(bis(1,1',1''-(phosphinetriyl)tripiperidine))palladium |
|---|
| Molecular Formula | C30H60Cl2N6P2Pd |
|---|---|
| Molecular Weight | 744.11100 |
| Exact Mass | 742.27700 |
| PSA | 46.62000 |
| LogP | 8.34840 |
| InChIKey | GNTXTSSDJRUYPK-UHFFFAOYSA-L |
| SMILES | C1CCN(P(N2CCCCC2)N2CCCCC2)CC1.C1CCN(P(N2CCCCC2)N2CCCCC2)CC1.Cl[Pd]Cl |
| RIDADR | NONH for all modes of transport |
|---|
|
Mizoroki-Heck reactions catalyzed by palladium dichloro-bis(aminophosphine) complexes under mild reaction conditions. The importance of ligand composition on the catalytic activity. Oberholzer, M. and Frech, C.M.
Green Chem. 15(6) , 1678, (2013)
|