9(Z),11(E),13(Z)-Octadecatrienoic Acid methyl ester structure
|
Common Name | 9(Z),11(E),13(Z)-Octadecatrienoic Acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 95497-55-5 | Molecular Weight | 292.456 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 386.5±21.0 °C at 760 mmHg | |
| Molecular Formula | C19H32O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.2±20.4 °C | |
Use of 9(Z),11(E),13(Z)-Octadecatrienoic Acid methyl ester9(Z),11(E),13(Z)-Octadecatrienoic acid methyl ester has been used as a standard for the quantification of 9(Z),11(E),13(Z)-octadecatrienoic acid in wild growing pomegranate seed oil. |
| Name | 9(Z),11(E),13(Z)-Octadecatrienoic Acid methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 386.5±21.0 °C at 760 mmHg |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.456 |
| Flash Point | 108.2±20.4 °C |
| Exact Mass | 292.240234 |
| LogP | 7.12 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.476 |
| InChIKey | KOJYENXGDXRGDK-KDQYYBQISA-N |
| SMILES | CCCCC=CC=CC=CCCCCCCCC(=O)OC |
| 9,11,13-Octadecatrienoic acid, methyl ester, (9Z,11E,13Z)- |
| Methyl (9Z,11E,13Z)-9,11,13-octadecatrienoate |