(3S)-3-cyclopentyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid
Modify Date: 2025-10-29 15:54:51
(3S)-3-cyclopentyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid structure
|
Common Name | (3S)-3-cyclopentyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 954225-72-0 | Molecular Weight | 379.449 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 601.7±38.0 °C at 760 mmHg | |
| Molecular Formula | C23H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.7±26.8 °C | |
| Name | (3S)-3-cyclopentyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 601.7±38.0 °C at 760 mmHg |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.449 |
| Flash Point | 317.7±26.8 °C |
| Exact Mass | 379.178345 |
| PSA | 79.12000 |
| LogP | 5.21 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | UUHBRVGMVCJAAL-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C1CCCC1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cyclopentanepropanoic acid, β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]- |
| (S)-3-cyclopentyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)-propanoic acid |
| 3-Cyclopentyl-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid |
| (S)-3-cyclopentyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)-propionic acid |