4-[3-(Methylamino)-1-(2-thienyl)propyl]-1-naphthalenol hydrochloride structure
|
Common Name | 4-[3-(Methylamino)-1-(2-thienyl)propyl]-1-naphthalenol hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 953028-76-7 | Molecular Weight | 333.87600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20ClNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[3-(Methylamino)-1-(2-thienyl)propyl]-1-naphthol hydrochloride (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H20ClNOS |
|---|---|
| Molecular Weight | 333.87600 |
| Exact Mass | 333.09500 |
| PSA | 60.50000 |
| LogP | 5.54120 |
| InChIKey | ZITBYVVDTPVWGL-UHFFFAOYSA-N |
| SMILES | CNCCC(c1cccs1)c1ccc(O)c2ccccc12.Cl |
|
~45%
4-[3-(Methylami... CAS#:953028-76-7 |
| Literature: Arava, Veera Reddy; Siripalli, Udaya Bhaskara Rao; Bandatmakuru, Sreenivasula Reddy Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2007 , vol. 46, # 10 p. 1695 - 1698 |
| 1-Piperazineacetamide,4-(4-methoxyphenyl)-N-2-pyridinyl |
| 2-(1-(4-(4-methoxyphenyl)piperazinyl))-N-(2-pyridyl)acetamide |
| 2-(1-(4-hydroxynaphth-1-yl)-3-(methylamino)propyl)-thiophene hydrochloride |
| 2-(1-(4-chlorophenyl)cyclopropyl)-3-hydroxy-8-(trifluoromethyl)quinoline-4-carboxylic acid |