4'-acetylcyclohexyl chlorobenzene
Modify Date: 2025-08-25 17:47:35
4'-acetylcyclohexyl chlorobenzene structure
|
Common Name | 4'-acetylcyclohexyl chlorobenzene | ||
|---|---|---|---|---|
| CAS Number | 95233-36-6 | Molecular Weight | 236.73700 | |
| Density | 1.107g/cm3 | Boiling Point | 341.7ºC at 760mmHg | |
| Molecular Formula | C14H17ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.8ºC | |
| Name | 4'-acetylcyclohexyl chlorobenzene |
|---|
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 341.7ºC at 760mmHg |
| Molecular Formula | C14H17ClO |
| Molecular Weight | 236.73700 |
| Flash Point | 197.8ºC |
| Exact Mass | 236.09700 |
| PSA | 17.07000 |
| LogP | 4.20280 |
| Index of Refraction | 1.531 |
| InChIKey | FLHSIPCMAJDSGB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1CCC(c2ccc(Cl)cc2)CC1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |