Methyl 5-amino-1H-pyrrolo[2,3-b]pyridine-2-carboxylate structure
|
Common Name | Methyl 5-amino-1H-pyrrolo[2,3-b]pyridine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 952182-18-2 | Molecular Weight | 191.187 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 5-amino-1H-pyrrolo[2,3-b]pyridine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.187 |
| Exact Mass | 191.069473 |
| PSA | 81.00000 |
| LogP | 1.50 |
| Index of Refraction | 1.706 |
| InChIKey | KBOWEPWOSHLMGE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2cc(N)cnc2[nH]1 |
| HS Code | 2933990090 |
|---|
|
~95%
Methyl 5-amino-... CAS#:952182-18-2 |
| Literature: NOVA DECISION; AZASYNTH; YASRI, Abdelaziz; CHEVE, Gwenael; BORIES, Cedric; DELON, Louis Patent: WO2010/92489 A1, 2010 ; Location in patent: Page/Page column 43 ; WO 2010/092489 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 5-amino-1H-pyrrolo[2,3-b]pyridine-2-carboxylate |
| 1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, 5-amino-, methyl ester |
| 5-amino-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid methyl ester |