ethyl 4-(4-chloro-3-methylphenyl)-4-oxobutanoate
Modify Date: 2025-09-24 23:38:46
ethyl 4-(4-chloro-3-methylphenyl)-4-oxobutanoate structure
|
Common Name | ethyl 4-(4-chloro-3-methylphenyl)-4-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 951890-12-3 | Molecular Weight | 254.70900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-(4-chloro-3-methylphenyl)-4-oxobutanoate |
|---|
| Molecular Formula | C13H15ClO3 |
|---|---|
| Molecular Weight | 254.70900 |
| Exact Mass | 254.07100 |
| PSA | 43.37000 |
| LogP | 3.17440 |
| InChIKey | RGHGWXKRISPCQY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(=O)c1ccc(Cl)c(C)c1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |