4-nitrobenzoic acid,(4-propan-2-ylphenyl)methanol
Modify Date: 2025-10-02 17:58:05
4-nitrobenzoic acid,(4-propan-2-ylphenyl)methanol structure
|
Common Name | 4-nitrobenzoic acid,(4-propan-2-ylphenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 95112-32-6 | Molecular Weight | 317.33600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-nitrobenzoic acid,(4-propan-2-ylphenyl)methanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H19NO5 |
|---|---|
| Molecular Weight | 317.33600 |
| Exact Mass | 317.12600 |
| PSA | 103.35000 |
| LogP | 4.11850 |
| InChIKey | HYCRXNNGYKXGTK-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(CO)cc1.O=C(O)c1ccc([N+](=O)[O-])cc1 |
|
~%
4-nitrobenzoic ... CAS#:95112-32-6 |
| Literature: Cooke; Gillespie; Macbeth Journal of the Chemical Society, 1938 , p. 1825 |
| p-i-Propylbenzylalkohol-p-nitrobenzoesaeureester |
| Benzenemethanol,4-(1-methylethyl)-,4-nitrobenzoate |
| 4-nitro-benzoic acid-(4-isopropyl-benzyl ester) |
| 4-Nitro-benzoesaeure-(4-isopropyl-benzylester) |