impletol depot Bayer structure
|
Common Name | impletol depot Bayer | ||
|---|---|---|---|---|
| CAS Number | 95017-34-8 | Molecular Weight | 541.64200 | |
| Density | N/A | Boiling Point | 373.6ºC at 760mmHg | |
| Molecular Formula | C27H39N7O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.8ºC | |
| Name | 2-(diethylamino)ethyl 4-aminobenzoate,1-ethenylpyrrolidin-2-one,1,3,7-trimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 373.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C27H39N7O5 |
| Molecular Weight | 541.64200 |
| Flash Point | 179.8ºC |
| Exact Mass | 541.30100 |
| PSA | 137.69000 |
| LogP | 2.00950 |
| InChIKey | ZQCYZBZGBRQYPB-UHFFFAOYSA-N |
| SMILES | C=CN1CCCC1=O.CCN(CC)CCOC(=O)c1ccc(N)cc1.Cn1c(=O)c2c(ncn2C)n(C)c1=O |
| Impletol depot bayer |
| Benzoic acid,4-amino-,2-(diethylamino)ethyl ester,mixt. with 3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione and 1-ethenyl-2-pyrrolidinone homopolymer |