Diamthazole structure
|
Common Name | Diamthazole | ||
|---|---|---|---|---|
| CAS Number | 95-27-2 | Molecular Weight | 293.42800 | |
| Density | 1.137g/cm3 | Boiling Point | 400.9ºC at 760mmHg | |
| Molecular Formula | C15H23N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.2ºC | |
Use of DiamthazoleDiamthazole (Dimazole) is an antifungal agent. Diamthazole can be used for the research of infection[1]. |
| Name | dimazole |
|---|---|
| Synonym | More Synonyms |
| Description | Diamthazole (Dimazole) is an antifungal agent. Diamthazole can be used for the research of infection[1]. |
|---|---|
| Related Catalog |
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 400.9ºC at 760mmHg |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.42800 |
| Flash Point | 196.2ºC |
| Exact Mass | 293.15600 |
| PSA | 56.84000 |
| LogP | 3.08290 |
| Index of Refraction | 1.601 |
| InChIKey | WGMYEOIMVYADRJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOc1ccc2nc(N(C)C)sc2c1 |
| HS Code | 2934999090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Dimazol [inn-spanish,french] |
| Diamazole |
| 6-(2-Diethylaminoethoxy)-2-dimethylaminobenzothiazole |
| Asterol |
| Atelor |
| [6-(2-diethylamino-ethoxy)-benzothiazol-2-yl]-dimethyl-amine |
| Diamethazol |
| [6-(2-Diaethylamino-aethoxy)-benzothiazol-2-yl]-dimethyl-amin |
| Diamethazole |
| Diamthazole |