4-Methoxybenzamide O-acetyloxime
Modify Date: 2025-08-22 23:12:05
4-Methoxybenzamide O-acetyloxime structure
|
Common Name | 4-Methoxybenzamide O-acetyloxime | ||
|---|---|---|---|---|
| CAS Number | 949-02-0 | Molecular Weight | 208.21400 | |
| Density | 1.18g/cm3 | Boiling Point | 334.7ºC at 760 mmHg | |
| Molecular Formula | C10H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.2ºC | |
| Name | [(E)-[amino-(4-methoxyphenyl)methylidene]amino] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 334.7ºC at 760 mmHg |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.21400 |
| Flash Point | 156.2ºC |
| Exact Mass | 208.08500 |
| PSA | 73.91000 |
| LogP | 1.57890 |
| Index of Refraction | 1.532 |
| InChIKey | ULTOOQAMLJIAOF-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(N)=NOC(C)=O)cc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| p-ANISAMIDOXIME,O-ACETYL |
| p-Anisamide,O-acetyloxime |
| O-Acetyl-p-anisamidoxime |
| O-Acetyl-4-methoxy-benzamidoxim |