2-HYDROXY-3,5-DI-tert-BUTYLDIPHENYLAMINE structure
|
Common Name | 2-HYDROXY-3,5-DI-tert-BUTYLDIPHENYLAMINE | ||
|---|---|---|---|---|
| CAS Number | 94876-25-2 | Molecular Weight | 297.43400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H27NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-anilino-4,6-ditert-butylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H27NO |
|---|---|
| Molecular Weight | 297.43400 |
| Exact Mass | 297.20900 |
| PSA | 32.26000 |
| LogP | 5.80380 |
| InChIKey | KFQVMAWFWXYDFH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Nc2ccccc2)c(O)c(C(C)(C)C)c1 |
| HS Code | 2922299090 |
|---|
|
~80%
2-HYDROXY-3,5-D... CAS#:94876-25-2 |
| Literature: Chaudhuri; Nazari Verani; Bill; Bothe; Weyhermueller; Wieghardt Journal of the American Chemical Society, 2001 , vol. 123, # 10 p. 2213 - 2223 |
|
~%
2-HYDROXY-3,5-D... CAS#:94876-25-2 |
| Literature: Maslovskaya; Petrikevich; Timoshchuk; Shadyro Russian Journal of General Chemistry, 1996 , vol. 66, # 11 p. 1842 - 1846 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,4-di-tert-butyl-6-(phenylamino)phenol |
| 2,6-di-tert-butyl-6-(phenylamino)phenol |
| 3,5-di-tert-butyl-2-hydroxy-N-phenylaniline |
| Phenol,2,4-bis(1,1-dimethylethyl)-6-(phenylamino) |
| 4,6-di-tert-butyl-N-phenyl-o-iminobenzoquinone |
| 2-Anilino-4,6-di-tert-butylphenol |
| N-phenyl-2-anilino-4,6-di-tert-butyl-phenol |
| UNII-JZ2G11CI62 |
| 2-phenylamino-4,6-di-tert-butylphenol |