4-(Bromomethyl)-3-(trifluoromethyl)-Benzoylchloride
Modify Date: 2025-08-25 21:07:38
4-(Bromomethyl)-3-(trifluoromethyl)-Benzoylchloride structure
|
Common Name | 4-(Bromomethyl)-3-(trifluoromethyl)-Benzoylchloride | ||
|---|---|---|---|---|
| CAS Number | 948553-14-8 | Molecular Weight | 301.48800 | |
| Density | 1.685 g/cm3 | Boiling Point | 281.7ºC at 760 mmHg | |
| Molecular Formula | C9H5BrClF3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(bromomethyl)-3-(trifluoromethyl)benzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.685 g/cm3 |
|---|---|
| Boiling Point | 281.7ºC at 760 mmHg |
| Molecular Formula | C9H5BrClF3O |
| Molecular Weight | 301.48800 |
| Exact Mass | 299.91600 |
| PSA | 17.07000 |
| LogP | 3.97930 |
| Index of Refraction | 1.517 |
| InChIKey | KDBGNVBIKFJPKS-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc(CBr)c(C(F)(F)F)c1 |
| HS Code | 2916399090 |
|---|
|
~%
4-(Bromomethyl)... CAS#:948553-14-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 16, # 5 p. 1421 - 1425 |
|
~%
4-(Bromomethyl)... CAS#:948553-14-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 16, # 5 p. 1421 - 1425 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-(Bromomethyl)-3-(trifluoromethyl)-Benzoylchloride |