Ethyl 2,2,3,3,4,4,5,5-octafluoro-5-[(1,1,1,2,3,3,3-heptafluoro-2- propanyl)oxy]pentanoate
Modify Date: 2025-08-25 17:33:49
![Ethyl 2,2,3,3,4,4,5,5-octafluoro-5-[(1,1,1,2,3,3,3-heptafluoro-2- propanyl)oxy]pentanoate Structure](https://image.chemsrc.com/caspic/444/948014-25-3.png)
Ethyl 2,2,3,3,4,4,5,5-octafluoro-5-[(1,1,1,2,3,3,3-heptafluoro-2- propanyl)oxy]pentanoate structure
|
Common Name | Ethyl 2,2,3,3,4,4,5,5-octafluoro-5-[(1,1,1,2,3,3,3-heptafluoro-2- propanyl)oxy]pentanoate | ||
|---|---|---|---|---|
| CAS Number | 948014-25-3 | Molecular Weight | 458.12100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H5F15O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 2,2,3,3,4,4,5,5-octafluoro-5-[(1,1,1,2,3,3,3-heptafluoro-2- propanyl)oxy]pentanoate |
|---|
| Molecular Formula | C10H5F15O3 |
|---|---|
| Molecular Weight | 458.12100 |
| Exact Mass | 458.00000 |
| PSA | 35.53000 |
| LogP | 4.85520 |
| InChIKey | JKIBXEUXUXYAHU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |