2-(4-Methoxyphenoxy)-4-methylaniline
Modify Date: 2025-10-18 12:14:01
2-(4-Methoxyphenoxy)-4-methylaniline structure
|
Common Name | 2-(4-Methoxyphenoxy)-4-methylaniline | ||
|---|---|---|---|---|
| CAS Number | 946716-51-4 | Molecular Weight | 229.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-Methoxyphenoxy)-4-methylaniline |
|---|
| Molecular Formula | C14H15NO2 |
|---|---|
| Molecular Weight | 229.27400 |
| Exact Mass | 229.11000 |
| PSA | 44.48000 |
| LogP | 3.95930 |
| InChIKey | YSUQMCNXDDAOKJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(Oc2cc(C)ccc2N)cc1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |