UHRF1 PHD inhibitor MLD5 structure
|
Common Name | UHRF1 PHD inhibitor MLD5 | ||
|---|---|---|---|---|
| CAS Number | 946347-36-0 | Molecular Weight | 459.561 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H29N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of UHRF1 PHD inhibitor MLD5UHRF1 PHD inhibitor MLD5 is a specific compound that selectively inhibits the UHRF1-histone interaction (IC50=7.4 uM), targets the PHD finger of UHRF1, specifically disrupting histone H3 arginine 2 interactions with the PHD finger.UHRF1 PHD inhibitor MLD5 inhibited binding between H3K9me3(FAM) and UHRF1 with IC50 of 24-26 uM, displace UHRF1-histone H3 binding in cells. |
| Name | UHRF1 PHD inhibitor MLD5 |
|---|
| Description | UHRF1 PHD inhibitor MLD5 is a specific compound that selectively inhibits the UHRF1-histone interaction (IC50=7.4 uM), targets the PHD finger of UHRF1, specifically disrupting histone H3 arginine 2 interactions with the PHD finger.UHRF1 PHD inhibitor MLD5 inhibited binding between H3K9me3(FAM) and UHRF1 with IC50 of 24-26 uM, displace UHRF1-histone H3 binding in cells. |
|---|---|
| References | 1. Wallace H Liu, et al. Biochemistry. 2022 Feb 10. |
| Molecular Formula | C23H29N3O5S |
|---|---|
| Molecular Weight | 459.561 |
| InChIKey | CTHPNEMRYXYLPP-UHFFFAOYSA-N |
| SMILES | CN1CCc2cc(C(CNS(=O)(=O)c3ccc4c(c3)OCCO4)N3CCOCC3)ccc21 |