1H-Indole,2,3-dihydro-2,3-dimethyl-1-(phenylsulfonyl)-
Modify Date: 2025-09-11 17:25:52
1H-Indole,2,3-dihydro-2,3-dimethyl-1-(phenylsulfonyl)- structure
|
Common Name | 1H-Indole,2,3-dihydro-2,3-dimethyl-1-(phenylsulfonyl)- | ||
|---|---|---|---|---|
| CAS Number | 94460-78-3 | Molecular Weight | 287.37700 | |
| Density | 1.213g/cm3 | Boiling Point | 405.4ºC at 760mmHg | |
| Molecular Formula | C16H17NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199ºC | |
| Name | cis-1-Benzolsulfonyl-2,3-dimethyl-indolin |
|---|
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 405.4ºC at 760mmHg |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.37700 |
| Flash Point | 199ºC |
| Exact Mass | 287.09800 |
| PSA | 45.76000 |
| LogP | 4.53330 |
| Index of Refraction | 1.596 |
| InChIKey | AVYMMPQENKSLPD-UHFFFAOYSA-N |
| SMILES | CC1c2ccccc2N(S(=O)(=O)c2ccccc2)C1C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |