1-(Trimethylstannyl)naphthalene
Modify Date: 2025-09-10 18:18:24
1-(Trimethylstannyl)naphthalene structure
|
Common Name | 1-(Trimethylstannyl)naphthalene | ||
|---|---|---|---|---|
| CAS Number | 944-85-4 | Molecular Weight | 290.96700 | |
| Density | N/A | Boiling Point | 309.5ºC at 760 mmHg | |
| Molecular Formula | C13H16Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.8ºC | |
| Name | trimethyl(naphthalen-1-yl)stannane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 309.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H16Sn |
| Molecular Weight | 290.96700 |
| Flash Point | 144.8ºC |
| Exact Mass | 292.02700 |
| LogP | 3.61010 |
| InChIKey | GJINSWLNWKLWCH-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C)c1cccc2ccccc12 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| trimethyl-naphthalen-1-yl-stannane |
| napthyltrimethyl stannane |
| Stannane,trimethyl-1-naphthyl |
| 1-(Trimethylstannyl)naphthalene |
| 1-Naphthyltrimethylstannane |
| Stannane,trimethyl-1-naphthalenyl |