26-(p-nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol, compound with iodine
Modify Date: 2025-08-25 19:13:54
26-(p-nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol, compound with iodine structure
|
Common Name | 26-(p-nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol, compound with iodine | ||
|---|---|---|---|---|
| CAS Number | 94349-40-3 | Molecular Weight | 870.63200 | |
| Density | N/A | Boiling Point | 662.1ºC at 760mmHg | |
| Molecular Formula | C33H60I2O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354.2ºC | |
| Name | molecular iodine,2-[2-[2-[2-[2-[2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 662.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C33H60I2O10 |
| Molecular Weight | 870.63200 |
| Flash Point | 354.2ºC |
| Exact Mass | 870.22800 |
| PSA | 103.30000 |
| LogP | 6.25500 |
| InChIKey | JZRWBNHLJVOEAT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCc1ccc(OCCOCCOCCOCCOCCOCCOCCOCCOCCO)cc1.II |
| Polyoxyethylene (9) nonyl phenyl ether iodine complex |
| PEG-9 Nonyl phenyl ether iodine complex |
| Polyethylene glycol 450 nonyl phenyl ether iodine complex |
| EINECS 305-157-1 |
| 26-(p-Nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol,compound with iodine |
| Nonoxynol-9 iodine |
| 26-(Nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol,compd. with iodine |