diphenyl[(phenylsulfonyl)methyl]phosphine oxide structure
|
Common Name | diphenyl[(phenylsulfonyl)methyl]phosphine oxide | ||
|---|---|---|---|---|
| CAS Number | 94333-12-7 | Molecular Weight | 356.37500 | |
| Density | 1.31±0.1 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 531.7±42.0 °C (760 mmHg) | |
| Molecular Formula | C19H17O3PS | Melting Point | 180-181 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Phosphine oxide, diphenyl[(phenylsulfonyl)methyl] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31±0.1 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 531.7±42.0 °C (760 mmHg) |
| Melting Point | 180-181 °C |
| Molecular Formula | C19H17O3PS |
| Molecular Weight | 356.37500 |
| Exact Mass | 356.06400 |
| PSA | 69.40000 |
| LogP | 4.51270 |
| InChIKey | JOQBGSBDKFITDP-UHFFFAOYSA-N |
| SMILES | O=P(CS(=O)(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Diphenyl((phenylsulfonyl)methyl)phosphine oxide |