bis[3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-9-(trifluoromethyl)decyl] hydrogen phosphate, compound with 2,2'-iminodiethanol (1:1) structure
|
Common Name | bis[3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-9-(trifluoromethyl)decyl] hydrogen phosphate, compound with 2,2'-iminodiethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94291-77-7 | Molecular Weight | 1195.35000 | |
| Density | N/A | Boiling Point | 554.9ºC at 760 mmHg | |
| Molecular Formula | C26H20F38NO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.4ºC | |
| Name | bis[3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-9-(trifluoromethyl)decyl] hydrogen phosphate,2-(2-hydroxyethylamino)ethanol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 554.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C26H20F38NO6P |
| Molecular Weight | 1195.35000 |
| Flash Point | 289.4ºC |
| Exact Mass | 1195.04000 |
| PSA | 118.06000 |
| LogP | 12.14110 |
| InChIKey | KWXNYGDGJKISHD-UHFFFAOYSA-N |
| SMILES | O=P(O)(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F.OCCNCCO |
| Bis(3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-hexadecafluoro-9-(trifluoromethyl)decyl) hydrogen phosphate,compound with 2,2'-iminodiethanol (1:1) |
| EINECS 304-903-3 |