3-[tris(octyloxy)silyl]propanethiol structure
|
Common Name | 3-[tris(octyloxy)silyl]propanethiol | ||
|---|---|---|---|---|
| CAS Number | 94291-66-4 | Molecular Weight | 490.89800 | |
| Density | 0.903g/cm3 | Boiling Point | 512.5ºC at 760mmHg | |
| Molecular Formula | C27H58O3SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.7ºC | |
| Name | 3-trioctoxysilylpropane-1-thiol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.903g/cm3 |
|---|---|
| Boiling Point | 512.5ºC at 760mmHg |
| Molecular Formula | C27H58O3SSi |
| Molecular Weight | 490.89800 |
| Flash Point | 263.7ºC |
| Exact Mass | 490.38800 |
| PSA | 66.49000 |
| LogP | 9.37650 |
| Index of Refraction | 1.46 |
| InChIKey | WEPFXPXOMFVBDZ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCO[Si](CCCS)(OCCCCCCCC)OCCCCCCCC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| einecs 304-892-5 |
| 3-[tris(octyloxy)silyl]propanethiol |