4,4'-bis[[6-anilino-4-[(2-hydroxyethyl)methylamino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonic acid, compound with 2,2',2''-nitrilotriethanol structure
|
Common Name | 4,4'-bis[[6-anilino-4-[(2-hydroxyethyl)methylamino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonic acid, compound with 2,2',2''-nitrilotriethanol | ||
|---|---|---|---|---|
| CAS Number | 94277-48-2 | Molecular Weight | 1006.12000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C44H55N13O11S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[[4-anilino-6-[2-hydroxyethyl(methyl)amino]-1,3,5-triazin-2-yl]amino]-2-[(E)-2-[4-[[4-anilino-6-[2-hydroxyethyl(methyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid,2-[bis(2-hydroxyethyl)amino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C44H55N13O11S2 |
|---|---|
| Molecular Weight | 1006.12000 |
| Exact Mass | 1005.36000 |
| PSA | 374.75000 |
| LogP | 2.66630 |
| InChIKey | KEJMEWLDHSWXPV-IERUDJENSA-N |
| SMILES | CN(CCO)c1nc(Nc2ccccc2)nc(Nc2ccc(C=Cc3ccc(Nc4nc(Nc5ccccc5)nc(N(C)CCO)n4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)n1.OCCN(CCO)CCO |
| EINECS 304-632-0 |
| 4,4'-Bis((6-anilino-4-((2-hydroxyethyl)methylamino)-1,3,5-triazin-2-yl)amino)stilbene-2,2'-disulphonic acid,compound with 2,2',2''-nitrilotriethanol |