PKN1/2-IN-1
Modify Date: 2025-11-07 18:30:42
PKN1/2-IN-1 structure
|
Common Name | PKN1/2-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 942425-34-5 | Molecular Weight | 241.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PKN1/2-IN-1PKN1/2-IN-1 is a potent, cell penetrant and selective PKN2 (PRK2) inhibitor (IC50=16 nM; Ki=8 nM)[1]. |
| Name | PKN1/2-IN-1 |
|---|
| Description | PKN1/2-IN-1 is a potent, cell penetrant and selective PKN2 (PRK2) inhibitor (IC50=16 nM; Ki=8 nM)[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 16 nM, Ki: 8 nM (PKN2)[1] IC50: 108 nM, Ki: 210 nM (PKN1)[1]. |
| References |
| Molecular Formula | C14H15N3O |
|---|---|
| Molecular Weight | 241.29 |
| InChIKey | RVODROMIHSQWCT-UHFFFAOYSA-N |
| SMILES | CCn1c(-c2ccncc2)cc2c1CCNC2=O |