triphenylpropylphosphonium, salt with 2-tert-butylphenol (1:1) structure
|
Common Name | triphenylpropylphosphonium, salt with 2-tert-butylphenol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94231-19-3 | Molecular Weight | 454.58300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H35OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-tert-butylphenolate,triphenyl(propyl)phosphanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C31H35OP |
|---|---|
| Molecular Weight | 454.58300 |
| Exact Mass | 454.24300 |
| PSA | 36.65000 |
| LogP | 7.51840 |
| InChIKey | YGPWJXCXHWEDFN-UHFFFAOYSA-M |
| SMILES | CC(C)(C)c1ccccc1[O-].CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| EINECS 303-834-6 |
| Triphenylpropylphosphonium,salt with 2-tert-butylphenol (1:1) |