Acetic acid,2-[[(4-nitrophenyl)methyl]dithio]-, methyl ester structure
|
Common Name | Acetic acid,2-[[(4-nitrophenyl)methyl]dithio]-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 94215-35-7 | Molecular Weight | 273.32900 | |
| Density | 1.376g/cm3 | Boiling Point | 407.3ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.1ºC | |
| Name | methyl 2-[(4-nitrophenyl)methyldisulfanyl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.376g/cm3 |
|---|---|
| Boiling Point | 407.3ºC at 760 mmHg |
| Molecular Formula | C10H11NO4S2 |
| Molecular Weight | 273.32900 |
| Flash Point | 200.1ºC |
| Exact Mass | 273.01300 |
| PSA | 122.72000 |
| LogP | 3.17240 |
| Index of Refraction | 1.616 |
| InChIKey | QXKKNZRCMRBLPV-UHFFFAOYSA-N |
| SMILES | COC(=O)CSSCc1ccc([N+](=O)[O-])cc1 |
|
~%
Acetic acid,2-[... CAS#:94215-35-7 |
| Literature: Hiskey,R.G. et al. Journal of Organic Chemistry, 1961 , vol. 26, p. 1152 - 1155 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Methyl ((4-(hydroxy(oxido)amino)benzyl)dithio)acetate |
| 5-p-Nitrophenyl-3,4-dithia-pentansaeure-methylester |
| S-(4-Nitro-benzylmercapto)-thioglykolsaeure-methylester |