diethyl 2-[(naphthalen-2-ylamino)methylidene]propanedioate structure
|
Common Name | diethyl 2-[(naphthalen-2-ylamino)methylidene]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 94165-39-6 | Molecular Weight | 313.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-[(naphthalen-2-ylamino)methylidene]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H19NO4 |
|---|---|
| Molecular Weight | 313.34800 |
| Exact Mass | 313.13100 |
| PSA | 64.63000 |
| LogP | 3.33480 |
| InChIKey | XVVCXZVQLDZION-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CNc1ccc2ccccc2c1)C(=O)OCC |
|
~%
diethyl 2-[(nap... CAS#:94165-39-6 |
| Literature: Foster et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1327,1330 |
| 2-(naphthalen-2-ylaminomethylene)-malonic acid diethyl ester |
| ([2]Naphthylamino-methylen)-malonsaeure-diaethylester |
| [N-(Naphthyl-(2))-formimidoyl]-malonsaeure-diaethylester |
| Propanedioic acid,[(2-naphthalenylamino)methylene]-,diethyl ester |
| Diethyl 2-naphthylaminomethylenemalonate |
| 2-<(Naphth-2-yl)-aminomethylen>-malonsaeurediaethylester |
| ([2]naphthylamino-methylene)-malonic acid diethyl ester |