5-[[4-(dimethylamino)phenyl]methylene]-1-methylbarbituric acid
Modify Date: 2025-09-18 17:08:03
![5-[[4-(dimethylamino)phenyl]methylene]-1-methylbarbituric acid Structure](https://image.chemsrc.com/caspic/099/94159-46-3.png)
5-[[4-(dimethylamino)phenyl]methylene]-1-methylbarbituric acid structure
|
Common Name | 5-[[4-(dimethylamino)phenyl]methylene]-1-methylbarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 94159-46-3 | Molecular Weight | 273.28700 | |
| Density | 1.308g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[[4-(dimethylamino)phenyl]methylidene]-1-methyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.308g/cm3 |
|---|---|
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.28700 |
| Exact Mass | 273.11100 |
| PSA | 73.21000 |
| LogP | 1.05800 |
| Index of Refraction | 1.641 |
| InChIKey | GFUZHTMFTUBOPD-UHFFFAOYSA-N |
| SMILES | CN1C(=O)NC(=O)C(=Cc2ccc(N(C)C)cc2)C1=O |
| HS Code | 2933540000 |
|---|
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 5-(4-dimethylamino-benzylidene)-1-methyl-pyrimidine-2,4,6-trione |
| 5-[(4-dimethylaminophenyl)methylidene]-1-methyl-1,3-diazinane-2,4,6-trione |
| 5-p-Dimethylaminobenzyliden-1-methylbarbitursaeure |
| 5-[[4-(DIMETHYLAMINO)PHENYL]METHYLENE]-1-METHYLBARBITURIC ACID |