Sebacic acid, compound with 1,3,5-triazine-2,4,6-triamine (1:1) structure
|
Common Name | Sebacic acid, compound with 1,3,5-triazine-2,4,6-triamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94159-18-9 | Molecular Weight | 328.36700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H24N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | decanedioic acid,1,3,5-triazine-2,4,6-triamine |
|---|
| Molecular Formula | C13H24N6O4 |
|---|---|
| Molecular Weight | 328.36700 |
| Exact Mass | 328.18600 |
| PSA | 191.33000 |
| LogP | 2.63820 |
| InChIKey | YRNURYHCEJJLHP-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)nc(N)n1.O=C(O)CCCCCCCCC(=O)O |