dinonylnaphthalenedisulphonic acid, compound with 4,4-dimethyloxazolidine (1:1) structure
|
Common Name | dinonylnaphthalenedisulphonic acid, compound with 4,4-dimethyloxazolidine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94139-25-0 | Molecular Weight | 641.92200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H55NO7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4-dimethyl-1,3-oxazolidine,3,4-di(nonyl)naphthalene-1,2-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C33H55NO7S2 |
|---|---|
| Molecular Weight | 641.92200 |
| Exact Mass | 641.34200 |
| PSA | 146.76000 |
| LogP | 10.75210 |
| InChIKey | FYTHMKUCSALLCG-UHFFFAOYSA-N |
| SMILES | CC1(C)COCN1.CCCCCCCCCc1c(S(=O)(=O)O)c(S(=O)(=O)O)c2ccccc2c1CCCCCCCCC |
| EINECS 303-041-5 |
| Dinonylnaphthalenedisulphonic acid,compound with 4,4-dimethyloxazolidine (1:1) |