2,2-bis(hydroxymethyl)propane-1,3-diyl dibutyrate structure
|
Common Name | 2,2-bis(hydroxymethyl)propane-1,3-diyl dibutyrate | ||
|---|---|---|---|---|
| CAS Number | 94108-25-5 | Molecular Weight | 276.32600 | |
| Density | 1.127g/cm3 | Boiling Point | 337.7ºC at 760mmHg | |
| Molecular Formula | C13H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.2ºC | |
| Name | [2-(butanoyloxymethyl)-3-hydroxy-2-(hydroxymethyl)propyl] butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 337.7ºC at 760mmHg |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.32600 |
| Flash Point | 113.2ºC |
| Exact Mass | 276.15700 |
| PSA | 93.06000 |
| LogP | 0.64400 |
| Index of Refraction | 1.473 |
| InChIKey | WVKOWOFPELTOBJ-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OCC(CO)(CO)COC(=O)CCC |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,2-Bis(hydroxymethyl)propane-1,3-diyl dibutyrate |
| EINECS 302-364-9 |