3-(diethylamino)-1,1-dithiophen-2-ylbutan-1-ol
Modify Date: 2024-01-10 19:21:04
3-(diethylamino)-1,1-dithiophen-2-ylbutan-1-ol structure
|
Common Name | 3-(diethylamino)-1,1-dithiophen-2-ylbutan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 94094-46-9 | Molecular Weight | 309.49000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23NOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(diethylamino)-1,1-dithiophen-2-ylbutan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H23NOS2 |
|---|---|
| Molecular Weight | 309.49000 |
| Exact Mass | 309.12200 |
| PSA | 79.95000 |
| LogP | 4.16590 |
| InChIKey | NZJFEOLIAORPNT-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(C)CC(O)(c1cccs1)c1cccs1 |
| HS Code | 2934999090 |
|---|
|
~%
3-(diethylamino... CAS#:94094-46-9 |
| Literature: Adamson Journal of the Chemical Society, 1950 , p. 885,889 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Diaethylamino-1,1-di-[2]thienyl-butan-1-ol |
| 3-diethylamino-1,1-di-[2]thienyl-butan-1-ol |
| EINECS 302-147-9 |