1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo-7H-purine-7-acetic acid, compound with N-(α-methylphenethyl)-γ-phenylbenzenepropylamine (1:1) structure
|
Common Name | 1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo-7H-purine-7-acetic acid, compound with N-(α-methylphenethyl)-γ-phenylbenzenepropylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 94088-42-3 | Molecular Weight | 567.67800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H37N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid,3,3-diphenyl-N-(1-phenylpropan-2-yl)propan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C33H37N5O4 |
|---|---|
| Molecular Weight | 567.67800 |
| Exact Mass | 567.28500 |
| PSA | 111.15000 |
| LogP | 4.33860 |
| InChIKey | DYCAMVNSMCVQIV-UHFFFAOYSA-N |
| SMILES | CC(Cc1ccccc1)NCCC(c1ccccc1)c1ccccc1.Cn1c(=O)c2c(ncn2CC(=O)O)n(C)c1=O |
| einecs 302-042-8 |