1,2-bis(ethenyl)benzene,2-(dimethylamino)ethyl 2-methylprop-2-enoate,methyl 2-methylprop-2-enoate
Modify Date: 2025-11-25 17:36:02
1,2-bis(ethenyl)benzene,2-(dimethylamino)ethyl 2-methylprop-2-enoate,methyl 2-methylprop-2-enoate structure
|
Common Name | 1,2-bis(ethenyl)benzene,2-(dimethylamino)ethyl 2-methylprop-2-enoate,methyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 94062-86-9 | Molecular Weight | 387.51200 | |
| Density | N/A | Boiling Point | 187ºC at 760mmHg | |
| Molecular Formula | C23H33NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 70.6ºC | |
| Name | 1,2-bis(ethenyl)benzene,2-(dimethylamino)ethyl 2-methylprop-2-enoate,methyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 187ºC at 760mmHg |
|---|---|
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.51200 |
| Flash Point | 70.6ºC |
| Exact Mass | 387.24100 |
| PSA | 55.84000 |
| LogP | 4.37540 |
| InChIKey | YUPMXOOUFZGYPI-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OCCN(C)C.C=Cc1ccccc1C=C |
| 2-Propenoic acid,2-methyl-,2-(dimethylamino)ethyl ester,polymer with diethenylbenzene and methyl 2-methyl-2-propenoate |