ethyl 3-oxo-6-phenyl-2,3,4,5-tetrahydropyridazine-4-carboxylate structure
|
Common Name | ethyl 3-oxo-6-phenyl-2,3,4,5-tetrahydropyridazine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 94011-50-4 | Molecular Weight | 246.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 6-oxo-3-phenyl-4,5-dihydro-1H-pyridazine-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14N2O3 |
|---|---|
| Molecular Weight | 246.26200 |
| Exact Mass | 246.10000 |
| PSA | 71.25000 |
| LogP | 0.80140 |
| InChIKey | UHDWMBABBXSTIR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC(c2ccccc2)=NNC1=O |
| HS Code | 2933990090 |
|---|
|
~58%
ethyl 3-oxo-6-p... CAS#:94011-50-4 |
| Literature: Wermuth; Schlewer; Bourguignon; Maghioros; Bouchet; Moire; Kan; Worms; Biziere Journal of Medicinal Chemistry, 1989 , vol. 32, # 3 p. 528 - 537 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 3-oxo-6-phenyl-2,3,4,5-tetrahydro-4-pyridazinecarboxylate |
| 3-oxo-6-phenyl-2,3,4,5-tetrahydro-pyridazine-4-carboxylic acid ethyl ester |
| HMS2650N11 |
| 4,5-Dihydro-4-(ethoxycarbonyl)-6-phenyl-3(2H)-pyridazinone |
| 3-Oxo-6-phenyl-2,3,4,5-tetrahydro-pyridazin-4-carbonsaeure-aethylester |
| 6-phenyl-4-ethoxycarbonyl-4,5-dihydro-3-(2H)-pyridazinone |