1-methylheptyl cyclopent-2-ene-1-acetate structure
|
Common Name | 1-methylheptyl cyclopent-2-ene-1-acetate | ||
|---|---|---|---|---|
| CAS Number | 93981-12-5 | Molecular Weight | 238.36600 | |
| Density | 0.932g/cm3 | Boiling Point | 302.1ºC at 760mmHg | |
| Molecular Formula | C15H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.6ºC | |
| Name | octan-2-yl 2-cyclopent-2-en-1-ylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.932g/cm3 |
|---|---|
| Boiling Point | 302.1ºC at 760mmHg |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.36600 |
| Flash Point | 95.6ºC |
| Exact Mass | 238.19300 |
| PSA | 26.30000 |
| LogP | 4.24480 |
| Index of Refraction | 1.466 |
| InChIKey | DGKKEXMAGIKVTE-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)OC(=O)CC1C=CCC1 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 1-Methylheptyl cyclopent-2-ene-1-acetate |
| 2-Cyclopentene-1-acetic acid,1-methylheptyl ester |
| EINECS 301-094-9 |