2,4-bis(2-methylphenoxy)-1-nitrobenzene
Modify Date: 2025-09-27 18:14:14
2,4-bis(2-methylphenoxy)-1-nitrobenzene structure
|
Common Name | 2,4-bis(2-methylphenoxy)-1-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 93980-94-0 | Molecular Weight | 335.35300 | |
| Density | 1.219g/cm3 | Boiling Point | 428.7ºC at 760mmHg | |
| Molecular Formula | C20H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.7ºC | |
| Name | 2,4-bis(2-methylphenoxy)-1-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 428.7ºC at 760mmHg |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.35300 |
| Flash Point | 159.7ºC |
| Exact Mass | 335.11600 |
| PSA | 64.28000 |
| LogP | 6.31940 |
| Index of Refraction | 1.609 |
| InChIKey | AGUUXLHIEOFRGU-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1Oc1ccc([N+](=O)[O-])c(Oc2ccccc2C)c1 |
| HS Code | 2909309090 |
|---|
|
~%
2,4-bis(2-methy... CAS#:93980-94-0 |
| Literature: Etabl. Kuhlmann Patent: US2141667 , 1937 ; Full Text Show Details Etabl. Kuhlmann Patent: DE708379 , 1937 ; DRP/DRBP Org.Chem. |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Nitro-1.3-di-o-tolyloxy-benzol |
| 1-nitro-2,4-bis-o-tolyloxy-benzene |
| 1-Nitro-2,4-bis-o-tolyloxy-benzol |
| EINECS 301-075-5 |