5-oxo-L-proline, compound with 2-chloro-N,N-diethyl-10H-phenothiazine-10-propylamine (1:1) structure
|
Common Name | 5-oxo-L-proline, compound with 2-chloro-N,N-diethyl-10H-phenothiazine-10-propylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93963-56-5 | Molecular Weight | 476.03100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H30ClN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2-chlorophenothiazin-10-yl)-N,N-diethylpropan-1-amine,(2S)-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H30ClN3O3S |
|---|---|
| Molecular Weight | 476.03100 |
| Exact Mass | 475.17000 |
| PSA | 101.67000 |
| LogP | 5.36510 |
| InChIKey | WGCPDTWUXDRYMR-HVDRVSQOSA-N |
| SMILES | CCN(CC)CCCN1c2ccccc2Sc2ccc(Cl)cc21.O=C1CCC(C(=O)O)N1 |
| einecs 300-799-9 |