cinnamic acid, compound with piperazine-1,4-diethanol (1:1) structure
|
Common Name | cinnamic acid, compound with piperazine-1,4-diethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 93942-30-4 | Molecular Weight | 322.39900 | |
| Density | N/A | Boiling Point | 546.5ºC at 760 mmHg | |
| Molecular Formula | C17H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.3ºC | |
| Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanol,(E)-3-phenylprop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 546.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.39900 |
| Flash Point | 284.3ºC |
| Exact Mass | 322.18900 |
| PSA | 84.24000 |
| LogP | 0.24880 |
| InChIKey | DLHIXDDEHOSZTF-UHDJGPCESA-N |
| SMILES | O=C(O)C=Cc1ccccc1.OCCN1CCN(CCO)CC1 |
| einecs 300-581-3 |