4,4'-bis[[4-amino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonic acid, compound with 2-aminoethanol (1:2) structure
|
Common Name | 4,4'-bis[[4-amino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonic acid, compound with 2-aminoethanol (1:2) | ||
|---|---|---|---|---|
| CAS Number | 93893-35-7 | Molecular Weight | 886.95600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H50N14O12S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[[4-amino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2-[(E)-2-[4-[[4-amino-6-[bis(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid,2-aminoethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C32H50N14O12S2 |
|---|---|
| Molecular Weight | 886.95600 |
| Exact Mass | 886.31700 |
| PSA | 466.76000 |
| InChIKey | MXWSRNRSKIKKRN-SEPHDYHBSA-N |
| SMILES | NCCO.NCCO.Nc1nc(Nc2ccc(C=Cc3ccc(Nc4nc(N)nc(N(CCO)CCO)n4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)nc(N(CCO)CCO)n1 |
| EINECS 299-623-0 |
| 4,4'-Bis((4-amino-6-(bis(2-hydroxyethyl)amino)-1,3,5-triazin-2-yl)amino)stilbene-2,2'-disulphonic acid,compound with 2-aminoethanol(1:2) |